C26H24ClN5O2 — CID 18779678
4-[[5-[butoxy-[6-(5-chloro-2-oxo-1-pyridinyl)-3-pyridinyl]methyl]imidazol-1-yl]methyl]benzonitrile (PubChem CID 18779678) has the molecular formula C26H24ClN5O2 and a molecular weight of 473.96 g/mol. Its IUPAC name is 4-[[5-[butoxy-[6-(5-chloro-2-oxo-1-pyridinyl)-3-pyridinyl]methyl]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-[butoxy-[6-(5-chloro-2-oxo-1-pyridinyl)-3-pyridinyl]methyl]imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 18779678 |
| Molecular Formula | C26H24ClN5O2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-[[5-[butoxy-[6-(5-chloro-2-oxo-1-pyridinyl)-3-pyridinyl]methyl]imidazol-1-yl]methyl]benzonitrile |
| SMILES | CCCCOC(c1ccc(-n2cc(Cl)ccc2=O)nc1)c1cncn1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H24ClN5O2/c1-2-3-12-34-26(21-8-10-24(30-14-21)32-17-22(27)9-11-25(32)33)23-15-29-18-31(23)16-20-6-4-19(13-28)5-7-20/h4-11,14-15,17-18,26H,2-3,12,16H2,1H3 |
| InChIKey | PRHVBCALMHGISK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 85.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|