About bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate
bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate (PubChem CID 18780408) has the molecular formula C36H39IO5S
and a molecular weight of 710.67 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate.
Molecular Properties
| Compound Name | bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate |
| PubChem CID | 18780408 |
| Molecular Formula | C36H39IO5S |
| Molecular Weight | 710.67 g/mol |
| Exact Mass | 710.16 |
| IUPAC Name | bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate |
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.COc1c2ccccc2c(OC)c2c(S(=O)(=O)[O-])cccc12 |
| InChI | InChI=1S/C20H26I.C16H14O5S/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-20-15-10-6-3-4-7-11(10)16(21-2)14-12(15)8-5-9-13(14)22(17,18)19/h7-14H,1-6H3;3-9H,1-2H3,(H,17,18,19)/q+1;/p-1 |
| InChIKey | UJDQNHZTHXWMFH-UHFFFAOYSA-M |
| XLogP | 5.32 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 710.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate?
The IUPAC name of bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate (CID 18780408) is bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate.
What is the SMILES notation for bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate?
The canonical SMILES for bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate is CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.COc1c2ccccc2c(OC)c2c(S(=O)(=O)[O-])cccc12.
What is the InChIKey of bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate?
The InChIKey is UJDQNHZTHXWMFH-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H26I.C16H14O5S/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-20-15-10-6-3-4-7-11(10)16(21-2)14-12(15)8-5-9-13(14)22(17,18)19/h7-14H,1-6H3;3-9H,1-2H3,(H,17,18,19)/q+1;/p-1.
What are the key properties of bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate?
bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate has a molecular weight of 710.67 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-tert-butylphenyl)iodanium;9,10-dimethoxyanthracene-1-sulfonate is sourced from PubChem (CID 18780408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).