About benzene-1,4-diamine;propane-1,2,3-triol
benzene-1,4-diamine;propane-1,2,3-triol (PubChem CID 18780450) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is benzene-1,4-diamine;propane-1,2,3-triol.
Molecular Properties
| Compound Name | benzene-1,4-diamine;propane-1,2,3-triol |
| PubChem CID | 18780450 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | benzene-1,4-diamine;propane-1,2,3-triol |
| SMILES | Nc1ccc(N)cc1.OCC(O)CO |
| InChI | InChI=1S/C6H8N2.C3H8O3/c7-5-1-2-6(8)4-3-5;4-1-3(6)2-5/h1-4H,7-8H2;3-6H,1-2H2 |
| InChIKey | PSIZGDZUQPSDHR-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diamine;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diamine;propane-1,2,3-triol?
The IUPAC name of benzene-1,4-diamine;propane-1,2,3-triol (CID 18780450) is benzene-1,4-diamine;propane-1,2,3-triol.
What is the SMILES notation for benzene-1,4-diamine;propane-1,2,3-triol?
The canonical SMILES for benzene-1,4-diamine;propane-1,2,3-triol is Nc1ccc(N)cc1.OCC(O)CO.
What is the InChIKey of benzene-1,4-diamine;propane-1,2,3-triol?
The InChIKey is PSIZGDZUQPSDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C3H8O3/c7-5-1-2-6(8)4-3-5;4-1-3(6)2-5/h1-4H,7-8H2;3-6H,1-2H2.
What are the key properties of benzene-1,4-diamine;propane-1,2,3-triol?
benzene-1,4-diamine;propane-1,2,3-triol has a molecular weight of 200.24 g/mol, XLogP of -0.82, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diamine;propane-1,2,3-triol is sourced from PubChem (CID 18780450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).