C23H20FNO5 — CID 18780627
dimethyl 6-ethyl-5-(4-fluorophenyl)-9-methoxy-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate (PubChem CID 18780627) has the molecular formula C23H20FNO5 and a molecular weight of 409.41 g/mol. Its IUPAC name is dimethyl 6-ethyl-5-(4-fluorophenyl)-9-methoxy-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate.
| Compound Name | dimethyl 6-ethyl-5-(4-fluorophenyl)-9-methoxy-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 18780627 |
| Molecular Formula | C23H20FNO5 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | dimethyl 6-ethyl-5-(4-fluorophenyl)-9-methoxy-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate |
| SMILES | CCc1c(-c2ccc(F)cc2)c2c(C(=O)OC)c(C(=O)OC)c3cc(OC)cc1n32 |
| InChI | InChI=1S/C23H20FNO5/c1-5-15-16-10-14(28-2)11-17-19(22(26)29-3)20(23(27)30-4)21(25(16)17)18(15)12-6-8-13(24)9-7-12/h6-11H,5H2,1-4H3 |
| InChIKey | WKYXFPNZRAXLPZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |