C21H16FNO5 — CID 18780630
6-ethyl-5-(3-fluoro-4-methoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid (PubChem CID 18780630) has the molecular formula C21H16FNO5 and a molecular weight of 381.36 g/mol. Its IUPAC name is 6-ethyl-5-(3-fluoro-4-methoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid.
| Compound Name | 6-ethyl-5-(3-fluoro-4-methoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18780630 |
| Molecular Formula | C21H16FNO5 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 6-ethyl-5-(3-fluoro-4-methoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid |
| SMILES | CCc1c(-c2ccc(OC)c(F)c2)c2c(C(=O)O)c(C(=O)O)c3cccc1n32 |
| InChI | InChI=1S/C21H16FNO5/c1-3-11-13-5-4-6-14-17(20(24)25)18(21(26)27)19(23(13)14)16(11)10-7-8-15(28-2)12(22)9-10/h4-9H,3H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | HQEHDJQTWABQTM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |