C19H22O3 — CID 18781619
2,4-dihydroxy-2,4-dimethyl-1,5-diphenylpentan-3-one (PubChem CID 18781619) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,4-dihydroxy-2,4-dimethyl-1,5-diphenylpentan-3-one.
| Compound Name | 2,4-dihydroxy-2,4-dimethyl-1,5-diphenylpentan-3-one |
|---|---|
| PubChem CID | 18781619 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2,4-dihydroxy-2,4-dimethyl-1,5-diphenylpentan-3-one |
| SMILES | CC(O)(Cc1ccccc1)C(=O)C(C)(O)Cc1ccccc1 |
| InChI | InChI=1S/C19H22O3/c1-18(21,13-15-9-5-3-6-10-15)17(20)19(2,22)14-16-11-7-4-8-12-16/h3-12,21-22H,13-14H2,1-2H3 |
| InChIKey | NDJCDNQKIINPMP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |