C25H31N3O — CID 18782339
8-(5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 18782339) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 8-(5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-(5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 18782339 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 8-(5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | Cc1ccc(C)c2c1CCC(N1CCC3(CC1)C(=O)NCN3c1ccccc1)C2 |
| InChI | InChI=1S/C25H31N3O/c1-18-8-9-19(2)23-16-21(10-11-22(18)23)27-14-12-25(13-15-27)24(29)26-17-28(25)20-6-4-3-5-7-20/h3-9,21H,10-17H2,1-2H3,(H,26,29) |
| InChIKey | AVTITQJIVAWSKS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |