About N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide
N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide (PubChem CID 18782973) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide.
Molecular Properties
| Compound Name | N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide |
| PubChem CID | 18782973 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide |
| SMILES | C=CCC(=O)NCCc1coc2ccc3c(c12)CCCO3 |
| InChI | InChI=1S/C17H19NO3/c1-2-4-16(19)18-9-8-12-11-21-15-7-6-14-13(17(12)15)5-3-10-20-14/h2,6-7,11H,1,3-5,8-10H2,(H,18,19) |
| InChIKey | JKYVNNABVCTRPL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide?
The IUPAC name of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide (CID 18782973) is N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide.
What is the SMILES notation for N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide?
The canonical SMILES for N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide is C=CCC(=O)NCCc1coc2ccc3c(c12)CCCO3.
What is the InChIKey of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide?
The InChIKey is JKYVNNABVCTRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-2-4-16(19)18-9-8-12-11-21-15-7-6-14-13(17(12)15)5-3-10-20-14/h2,6-7,11H,1,3-5,8-10H2,(H,18,19).
What are the key properties of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide?
N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide has a molecular weight of 285.34 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-3-enamide is sourced from PubChem (CID 18782973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).