About N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide
N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide (PubChem CID 18782978) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide |
| PubChem CID | 18782978 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CCc1coc2ccc3c(c12)CCCO3 |
| InChI | InChI=1S/C16H19NO3/c1-11(18)17(2)8-7-12-10-20-15-6-5-14-13(16(12)15)4-3-9-19-14/h5-6,10H,3-4,7-9H2,1-2H3 |
| InChIKey | COEIQDDBGCDZGL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide?
The IUPAC name of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide (CID 18782978) is N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide.
What is the SMILES notation for N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide?
The canonical SMILES for N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide is CC(=O)N(C)CCc1coc2ccc3c(c12)CCCO3.
What is the InChIKey of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide?
The InChIKey is COEIQDDBGCDZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-11(18)17(2)8-7-12-10-20-15-6-5-14-13(16(12)15)4-3-9-19-14/h5-6,10H,3-4,7-9H2,1-2H3.
What are the key properties of N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide?
N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide has a molecular weight of 273.33 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]-N-methylacetamide is sourced from PubChem (CID 18782978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).