About N,N-diethyldodecanamide
N,N-diethyldodecanamide (PubChem CID 18783) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is N,N-diethyldodecanamide.
Molecular Properties
| Compound Name | N,N-diethyldodecanamide |
| PubChem CID | 18783 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | N,N-diethyldodecanamide |
| SMILES | CCCCCCCCCCCC(=O)N(CC)CC |
| InChI | InChI=1S/C16H33NO/c1-4-7-8-9-10-11-12-13-14-15-16(18)17(5-2)6-3/h4-15H2,1-3H3 |
| InChIKey | CWNSVVHTTQBGQB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyldodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyldodecanamide?
The IUPAC name of N,N-diethyldodecanamide (CID 18783) is N,N-diethyldodecanamide.
What is the SMILES notation for N,N-diethyldodecanamide?
The canonical SMILES for N,N-diethyldodecanamide is CCCCCCCCCCCC(=O)N(CC)CC.
What is the InChIKey of N,N-diethyldodecanamide?
The InChIKey is CWNSVVHTTQBGQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO/c1-4-7-8-9-10-11-12-13-14-15-16(18)17(5-2)6-3/h4-15H2,1-3H3.
What are the key properties of N,N-diethyldodecanamide?
N,N-diethyldodecanamide has a molecular weight of 255.45 g/mol, XLogP of 4.78, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyldodecanamide is sourced from PubChem (CID 18783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).