C17H19NO3 — CID 18783021
(E)-N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-2-enamide (PubChem CID 18783021) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (E)-N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-2-enamide.
| Compound Name | (E)-N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 18783021 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (E)-N-[2-(8,9-dihydro-7H-furo[3,2-f]chromen-1-yl)ethyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCc1coc2ccc3c(c12)CCCO3 |
| InChI | InChI=1S/C17H19NO3/c1-2-4-16(19)18-9-8-12-11-21-15-7-6-14-13(17(12)15)5-3-10-20-14/h2,4,6-7,11H,3,5,8-10H2,1H3,(H,18,19)/b4-2+ |
| InChIKey | MJWMMQXOSZTGPR-DUXPYHPUSA-N |
| XLogP | 2.99 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|