C11H11BrCl2O2 — CID 18783120
4-bromo-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-3-ol (PubChem CID 18783120) has the molecular formula C11H11BrCl2O2 and a molecular weight of 326.02 g/mol. Its IUPAC name is 4-bromo-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-3-ol.
| Compound Name | 4-bromo-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 18783120 |
| Molecular Formula | C11H11BrCl2O2 |
| Molecular Weight | 326.02 g/mol |
| Exact Mass | 323.93 |
| IUPAC Name | 4-bromo-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2c(Cl)cc(Cl)cc2C(Br)C1O |
| InChI | InChI=1S/C11H11BrCl2O2/c1-11(2)10(15)8(12)6-3-5(13)4-7(14)9(6)16-11/h3-4,8,10,15H,1-2H3 |
| InChIKey | WUXLIRTUXHXRNA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.02 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|