C12H10FNO2 — CID 18783125
5-fluoro-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-carbonitrile (PubChem CID 18783125) has the molecular formula C12H10FNO2 and a molecular weight of 219.21 g/mol. Its IUPAC name is 5-fluoro-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-carbonitrile.
| Compound Name | 5-fluoro-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-carbonitrile |
|---|---|
| PubChem CID | 18783125 |
| Molecular Formula | C12H10FNO2 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 5-fluoro-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-carbonitrile |
| SMILES | CC1(C)Oc2cc(F)c(C#N)cc2C2OC21 |
| InChI | InChI=1S/C12H10FNO2/c1-12(2)11-10(15-11)7-3-6(5-14)8(13)4-9(7)16-12/h3-4,10-11H,1-2H3 |
| InChIKey | NIXHGKABIGRLAG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|