C14H27N3 — CID 18783144
5-(2-azido-2-methylpropyl)-1,1,3,3-tetramethylcyclohexane (PubChem CID 18783144) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 5-(2-azido-2-methylpropyl)-1,1,3,3-tetramethylcyclohexane.
| Compound Name | 5-(2-azido-2-methylpropyl)-1,1,3,3-tetramethylcyclohexane |
|---|---|
| PubChem CID | 18783144 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 5-(2-azido-2-methylpropyl)-1,1,3,3-tetramethylcyclohexane |
| SMILES | CC1(C)CC(CC(C)(C)N=[N+]=[N-])CC(C)(C)C1 |
| InChI | InChI=1S/C14H27N3/c1-12(2)7-11(8-13(3,4)10-12)9-14(5,6)16-17-15/h11H,7-10H2,1-6H3 |
| InChIKey | XPLOLFCBYGPWPZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|