About N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide
N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide (PubChem CID 18783191) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide |
| PubChem CID | 18783191 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(O)CCO |
| InChI | InChI=1S/C7H13NO3/c1-5(2)7(11)8-6(10)3-4-9/h6,9-10H,1,3-4H2,2H3,(H,8,11) |
| InChIKey | FXDMMGMXCHWCJP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide?
The IUPAC name of N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide (CID 18783191) is N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide.
What is the SMILES notation for N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide?
The canonical SMILES for N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide is C=C(C)C(=O)NC(O)CCO.
What is the InChIKey of N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide?
The InChIKey is FXDMMGMXCHWCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-5(2)7(11)8-6(10)3-4-9/h6,9-10H,1,3-4H2,2H3,(H,8,11).
What are the key properties of N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide?
N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide has a molecular weight of 159.18 g/mol, XLogP of -0.62, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dihydroxypropyl)-2-methylprop-2-enamide is sourced from PubChem (CID 18783191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).