C13H12N2 — CID 18783557
3,13-diazatricyclo[8.3.1.12,6]pentadeca-1(13),2,4,6(15),10(14),11-hexaene (PubChem CID 18783557) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3,13-diazatricyclo[8.3.1.12,6]pentadeca-1(13),2,4,6(15),10(14),11-hexaene.
| Compound Name | 3,13-diazatricyclo[8.3.1.12,6]pentadeca-1(13),2,4,6(15),10(14),11-hexaene |
|---|---|
| PubChem CID | 18783557 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3,13-diazatricyclo[8.3.1.12,6]pentadeca-1(13),2,4,6(15),10(14),11-hexaene |
| SMILES | c1cc2cc(n1)-c1cc(ccn1)CCC2 |
| InChI | InChI=1S/C13H12N2/c1-2-10-4-6-14-12(8-10)13-9-11(3-1)5-7-15-13/h4-9H,1-3H2 |
| InChIKey | SYRCZJWWJFKCNV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |