About 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid
1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid (PubChem CID 18784424) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid |
| PubChem CID | 18784424 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid |
| SMILES | C=C1CC(=O)C(C)(C(=O)O)C1=O |
| InChI | InChI=1S/C8H8O4/c1-4-3-5(9)8(2,6(4)10)7(11)12/h1,3H2,2H3,(H,11,12) |
| InChIKey | FJGPRVLCLJJWCO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid?
The IUPAC name of 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid (CID 18784424) is 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid?
The canonical SMILES for 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid is C=C1CC(=O)C(C)(C(=O)O)C1=O.
What is the InChIKey of 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid?
The InChIKey is FJGPRVLCLJJWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c1-4-3-5(9)8(2,6(4)10)7(11)12/h1,3H2,2H3,(H,11,12).
What are the key properties of 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid?
1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of 0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-methylidene-2,5-dioxocyclopentane-1-carboxylic acid is sourced from PubChem (CID 18784424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).