About 4-hydroxy-2-methylpenta-2,3-dienal
4-hydroxy-2-methylpenta-2,3-dienal (PubChem CID 18784519) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is 4-hydroxy-2-methylpenta-2,3-dienal.
Molecular Properties
| Compound Name | 4-hydroxy-2-methylpenta-2,3-dienal |
| PubChem CID | 18784519 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 4-hydroxy-2-methylpenta-2,3-dienal |
| SMILES | CC(O)=C=C(C)C=O |
| InChI | InChI=1S/C6H8O2/c1-5(4-7)3-6(2)8/h4,8H,1-2H3 |
| InChIKey | HQNPFPMYTOAXKT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2-methylpenta-2,3-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-methylpenta-2,3-dienal?
The IUPAC name of 4-hydroxy-2-methylpenta-2,3-dienal (CID 18784519) is 4-hydroxy-2-methylpenta-2,3-dienal.
What is the SMILES notation for 4-hydroxy-2-methylpenta-2,3-dienal?
The canonical SMILES for 4-hydroxy-2-methylpenta-2,3-dienal is CC(O)=C=C(C)C=O.
What is the InChIKey of 4-hydroxy-2-methylpenta-2,3-dienal?
The InChIKey is HQNPFPMYTOAXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-5(4-7)3-6(2)8/h4,8H,1-2H3.
What are the key properties of 4-hydroxy-2-methylpenta-2,3-dienal?
4-hydroxy-2-methylpenta-2,3-dienal has a molecular weight of 112.13 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-methylpenta-2,3-dienal is sourced from PubChem (CID 18784519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).