About 3-ethyl-1,3-dimethylpyrrolidin-2-one
3-ethyl-1,3-dimethylpyrrolidin-2-one (PubChem CID 18784905) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 3-ethyl-1,3-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-1,3-dimethylpyrrolidin-2-one |
| PubChem CID | 18784905 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 3-ethyl-1,3-dimethylpyrrolidin-2-one |
| SMILES | CCC1(C)CCN(C)C1=O |
| InChI | InChI=1S/C8H15NO/c1-4-8(2)5-6-9(3)7(8)10/h4-6H2,1-3H3 |
| InChIKey | XYIIWMLRCHTNHQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1,3-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,3-dimethylpyrrolidin-2-one?
The IUPAC name of 3-ethyl-1,3-dimethylpyrrolidin-2-one (CID 18784905) is 3-ethyl-1,3-dimethylpyrrolidin-2-one.
What is the SMILES notation for 3-ethyl-1,3-dimethylpyrrolidin-2-one?
The canonical SMILES for 3-ethyl-1,3-dimethylpyrrolidin-2-one is CCC1(C)CCN(C)C1=O.
What is the InChIKey of 3-ethyl-1,3-dimethylpyrrolidin-2-one?
The InChIKey is XYIIWMLRCHTNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-8(2)5-6-9(3)7(8)10/h4-6H2,1-3H3.
What are the key properties of 3-ethyl-1,3-dimethylpyrrolidin-2-one?
3-ethyl-1,3-dimethylpyrrolidin-2-one has a molecular weight of 141.21 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,3-dimethylpyrrolidin-2-one is sourced from PubChem (CID 18784905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).