C8H2O4S2 — CID 18785234
[1,3]oxathiolo[4,5-f][1,3]benzoxathiole-2,6-dione (PubChem CID 18785234) has the molecular formula C8H2O4S2 and a molecular weight of 226.23 g/mol. Its IUPAC name is [1,3]oxathiolo[4,5-f][1,3]benzoxathiole-2,6-dione.
| Compound Name | [1,3]oxathiolo[4,5-f][1,3]benzoxathiole-2,6-dione |
|---|---|
| PubChem CID | 18785234 |
| Molecular Formula | C8H2O4S2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 225.94 |
| IUPAC Name | [1,3]oxathiolo[4,5-f][1,3]benzoxathiole-2,6-dione |
| SMILES | O=c1oc2cc3oc(=O)sc3cc2s1 |
| InChI | InChI=1S/C8H2O4S2/c9-7-11-3-1-4-6(2-5(3)13-7)14-8(10)12-4/h1-2H |
| InChIKey | DIPYFGOCHHTOQQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |