C15H15F9O9S3 — CID 18785326
[3,4-bis(1,1,1-trifluoropropan-2-ylsulfonyloxy)phenyl] 1,1,1-trifluoropropane-2-sulfonate (PubChem CID 18785326) has the molecular formula C15H15F9O9S3 and a molecular weight of 606.46 g/mol. Its IUPAC name is [3,4-bis(1,1,1-trifluoropropan-2-ylsulfonyloxy)phenyl] 1,1,1-trifluoropropane-2-sulfonate.
| Compound Name | [3,4-bis(1,1,1-trifluoropropan-2-ylsulfonyloxy)phenyl] 1,1,1-trifluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 18785326 |
| Molecular Formula | C15H15F9O9S3 |
| Molecular Weight | 606.46 g/mol |
| Exact Mass | 605.97 |
| IUPAC Name | [3,4-bis(1,1,1-trifluoropropan-2-ylsulfonyloxy)phenyl] 1,1,1-trifluoropropane-2-sulfonate |
| SMILES | CC(C(F)(F)F)S(=O)(=O)Oc1ccc(OS(=O)(=O)C(C)C(F)(F)F)c(OS(=O)(=O)C(C)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F9O9S3/c1-7(13(16,17)18)34(25,26)31-10-4-5-11(32-35(27,28)8(2)14(19,20)21)12(6-10)33-36(29,30)9(3)15(22,23)24/h4-9H,1-3H3 |
| InChIKey | AFVRYMNHGNTVOC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|