C13H26N6O5 — CID 18785363
2-N,2-N,4-N,4-N,6-N-pentakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 18785363) has the molecular formula C13H26N6O5 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N-pentakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N-pentakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18785363 |
| Molecular Formula | C13H26N6O5 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N-pentakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COCNc1nc(N(COC)COC)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C13H26N6O5/c1-20-6-14-11-15-12(18(7-21-2)8-22-3)17-13(16-11)19(9-23-4)10-24-5/h6-10H2,1-5H3,(H,14,15,16,17) |
| InChIKey | LEVZZYOVVQKGOM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|