About 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine
2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine (PubChem CID 18785697) has the molecular formula C18H19N3O
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine |
| PubChem CID | 18785697 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine |
| SMILES | C=CCn1c(C)c(C)c2cnnc(OCc3ccccc3)c21 |
| InChI | InChI=1S/C18H19N3O/c1-4-10-21-14(3)13(2)16-11-19-20-18(17(16)21)22-12-15-8-6-5-7-9-15/h4-9,11H,1,10,12H2,2-3H3 |
| InChIKey | JLBHHQHEPNWMTE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine?
The IUPAC name of 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine (CID 18785697) is 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine.
What is the SMILES notation for 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine?
The canonical SMILES for 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine is C=CCn1c(C)c(C)c2cnnc(OCc3ccccc3)c21.
What is the InChIKey of 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine?
The InChIKey is JLBHHQHEPNWMTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O/c1-4-10-21-14(3)13(2)16-11-19-20-18(17(16)21)22-12-15-8-6-5-7-9-15/h4-9,11H,1,10,12H2,2-3H3.
What are the key properties of 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine?
2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine has a molecular weight of 293.37 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-7-phenylmethoxy-1-prop-2-enylpyrrolo[2,3-d]pyridazine is sourced from PubChem (CID 18785697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).