About 3-ethynyl-3,4-dihydroisoquinolin-1-amine
3-ethynyl-3,4-dihydroisoquinolin-1-amine (PubChem CID 18785825) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-ethynyl-3,4-dihydroisoquinolin-1-amine.
Molecular Properties
| Compound Name | 3-ethynyl-3,4-dihydroisoquinolin-1-amine |
| PubChem CID | 18785825 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 3-ethynyl-3,4-dihydroisoquinolin-1-amine |
| SMILES | C#CC1Cc2ccccc2C(N)=N1 |
| InChI | InChI=1S/C11H10N2/c1-2-9-7-8-5-3-4-6-10(8)11(12)13-9/h1,3-6,9H,7H2,(H2,12,13) |
| InChIKey | SGASAPRGFSSJCC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-3,4-dihydroisoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-3,4-dihydroisoquinolin-1-amine?
The IUPAC name of 3-ethynyl-3,4-dihydroisoquinolin-1-amine (CID 18785825) is 3-ethynyl-3,4-dihydroisoquinolin-1-amine.
What is the SMILES notation for 3-ethynyl-3,4-dihydroisoquinolin-1-amine?
The canonical SMILES for 3-ethynyl-3,4-dihydroisoquinolin-1-amine is C#CC1Cc2ccccc2C(N)=N1.
What is the InChIKey of 3-ethynyl-3,4-dihydroisoquinolin-1-amine?
The InChIKey is SGASAPRGFSSJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-9-7-8-5-3-4-6-10(8)11(12)13-9/h1,3-6,9H,7H2,(H2,12,13).
What are the key properties of 3-ethynyl-3,4-dihydroisoquinolin-1-amine?
3-ethynyl-3,4-dihydroisoquinolin-1-amine has a molecular weight of 170.21 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-3,4-dihydroisoquinolin-1-amine is sourced from PubChem (CID 18785825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).