About 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine
3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine (PubChem CID 18785891) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine.
Molecular Properties
| Compound Name | 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine |
| PubChem CID | 18785891 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine |
| SMILES | Cc1cccc(C2Cc3ccccc3C(N)=N2)c1 |
| InChI | InChI=1S/C16H16N2/c1-11-5-4-7-13(9-11)15-10-12-6-2-3-8-14(12)16(17)18-15/h2-9,15H,10H2,1H3,(H2,17,18) |
| InChIKey | QLTIDNDKPCSXEY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine?
The IUPAC name of 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine (CID 18785891) is 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine.
What is the SMILES notation for 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine?
The canonical SMILES for 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine is Cc1cccc(C2Cc3ccccc3C(N)=N2)c1.
What is the InChIKey of 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine?
The InChIKey is QLTIDNDKPCSXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2/c1-11-5-4-7-13(9-11)15-10-12-6-2-3-8-14(12)16(17)18-15/h2-9,15H,10H2,1H3,(H2,17,18).
What are the key properties of 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine?
3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine has a molecular weight of 236.32 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylphenyl)-3,4-dihydroisoquinolin-1-amine is sourced from PubChem (CID 18785891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).