About 6,7-dihydrothieno[3,2-c]pyridin-4-amine
6,7-dihydrothieno[3,2-c]pyridin-4-amine (PubChem CID 18785892) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is 6,7-dihydrothieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 6,7-dihydrothieno[3,2-c]pyridin-4-amine |
| PubChem CID | 18785892 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 6,7-dihydrothieno[3,2-c]pyridin-4-amine |
| SMILES | NC1=NCCc2sccc21 |
| InChI | InChI=1S/C7H8N2S/c8-7-5-2-4-10-6(5)1-3-9-7/h2,4H,1,3H2,(H2,8,9) |
| InChIKey | LQTSFUGQZYFQQE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydrothieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydrothieno[3,2-c]pyridin-4-amine?
The IUPAC name of 6,7-dihydrothieno[3,2-c]pyridin-4-amine (CID 18785892) is 6,7-dihydrothieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for 6,7-dihydrothieno[3,2-c]pyridin-4-amine?
The canonical SMILES for 6,7-dihydrothieno[3,2-c]pyridin-4-amine is NC1=NCCc2sccc21.
What is the InChIKey of 6,7-dihydrothieno[3,2-c]pyridin-4-amine?
The InChIKey is LQTSFUGQZYFQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S/c8-7-5-2-4-10-6(5)1-3-9-7/h2,4H,1,3H2,(H2,8,9).
What are the key properties of 6,7-dihydrothieno[3,2-c]pyridin-4-amine?
6,7-dihydrothieno[3,2-c]pyridin-4-amine has a molecular weight of 152.22 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydrothieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 18785892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).