C18H23Cl2N3O — CID 18785925
3-[3-(3-aminopropoxy)phenyl]-3,4-dihydroisoquinolin-1-amine;dihydrochloride (PubChem CID 18785925) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is 3-[3-(3-aminopropoxy)phenyl]-3,4-dihydroisoquinolin-1-amine;dihydrochloride.
| Compound Name | 3-[3-(3-aminopropoxy)phenyl]-3,4-dihydroisoquinolin-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 18785925 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[3-(3-aminopropoxy)phenyl]-3,4-dihydroisoquinolin-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NCCCOc1cccc(C2Cc3ccccc3C(N)=N2)c1 |
| InChI | InChI=1S/C18H21N3O.2ClH/c19-9-4-10-22-15-7-3-6-14(11-15)17-12-13-5-1-2-8-16(13)18(20)21-17;;/h1-3,5-8,11,17H,4,9-10,12,19H2,(H2,20,21);2*1H |
| InChIKey | OQTWUIJTRJFISH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|