About 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride
5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride (PubChem CID 18785927) has the molecular formula C15H14ClFN2
and a molecular weight of 276.74 g/mol. Its IUPAC name is 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride |
| PubChem CID | 18785927 |
| Molecular Formula | C15H14ClFN2 |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride |
| SMILES | Cl.NC1=NC(c2ccccc2)Cc2c(F)cccc21 |
| InChI | InChI=1S/C15H13FN2.ClH/c16-13-8-4-7-11-12(13)9-14(18-15(11)17)10-5-2-1-3-6-10;/h1-8,14H,9H2,(H2,17,18);1H |
| InChIKey | YAEMVJAUQOINFD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride?
The IUPAC name of 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride (CID 18785927) is 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride.
What is the SMILES notation for 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride?
The canonical SMILES for 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride is Cl.NC1=NC(c2ccccc2)Cc2c(F)cccc21.
What is the InChIKey of 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride?
The InChIKey is YAEMVJAUQOINFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN2.ClH/c16-13-8-4-7-11-12(13)9-14(18-15(11)17)10-5-2-1-3-6-10;/h1-8,14H,9H2,(H2,17,18);1H.
What are the key properties of 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride?
5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride has a molecular weight of 276.74 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-phenyl-3,4-dihydroisoquinolin-1-amine;hydrochloride is sourced from PubChem (CID 18785927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).