About 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine
6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine (PubChem CID 18785938) has the molecular formula C13H12N2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine |
| PubChem CID | 18785938 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine |
| SMILES | NC1=NC(c2ccccc2)Cc2sccc21 |
| InChI | InChI=1S/C13H12N2S/c14-13-10-6-7-16-12(10)8-11(15-13)9-4-2-1-3-5-9/h1-7,11H,8H2,(H2,14,15) |
| InChIKey | LZAUMHCTCUKFMR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine?
The IUPAC name of 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine (CID 18785938) is 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine?
The canonical SMILES for 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine is NC1=NC(c2ccccc2)Cc2sccc21.
What is the InChIKey of 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine?
The InChIKey is LZAUMHCTCUKFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2S/c14-13-10-6-7-16-12(10)8-11(15-13)9-4-2-1-3-5-9/h1-7,11H,8H2,(H2,14,15).
What are the key properties of 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine?
6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine has a molecular weight of 228.32 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-6,7-dihydrothieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 18785938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).