C24H22F2N2O3S — CID 18786430
S-[4-[4-[1-[(2,6-difluorobenzoyl)amino]-2-hydroxyethyl]phenyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 18786430) has the molecular formula C24H22F2N2O3S and a molecular weight of 456.51 g/mol. Its IUPAC name is S-[4-[4-[1-[(2,6-difluorobenzoyl)amino]-2-hydroxyethyl]phenyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[4-[1-[(2,6-difluorobenzoyl)amino]-2-hydroxyethyl]phenyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 18786430 |
| Molecular Formula | C24H22F2N2O3S |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | S-[4-[4-[1-[(2,6-difluorobenzoyl)amino]-2-hydroxyethyl]phenyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(-c2ccc(C(CO)NC(=O)c3c(F)cccc3F)cc2)cc1 |
| InChI | InChI=1S/C24H22F2N2O3S/c1-28(2)24(31)32-18-12-10-16(11-13-18)15-6-8-17(9-7-15)21(14-29)27-23(30)22-19(25)4-3-5-20(22)26/h3-13,21,29H,14H2,1-2H3,(H,27,30) |
| InChIKey | KTTFRSDVLRWSJP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|