About hydron;triethylazanium;sulfate
hydron;triethylazanium;sulfate (PubChem CID 18786689) has the molecular formula C6H17NO4S
and a molecular weight of 199.27 g/mol. Its IUPAC name is hydron;triethylazanium;sulfate.
Molecular Properties
| Compound Name | hydron;triethylazanium;sulfate |
| PubChem CID | 18786689 |
| Molecular Formula | C6H17NO4S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | hydron;triethylazanium;sulfate |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C6H15N.H2O4S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | JNONJXMVMJSMTC-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydron;triethylazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;triethylazanium;sulfate?
The IUPAC name of hydron;triethylazanium;sulfate (CID 18786689) is hydron;triethylazanium;sulfate.
What is the SMILES notation for hydron;triethylazanium;sulfate?
The canonical SMILES for hydron;triethylazanium;sulfate is CC[NH+](CC)CC.O=S(=O)([O-])[O-].[H+].
What is the InChIKey of hydron;triethylazanium;sulfate?
The InChIKey is JNONJXMVMJSMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.H2O4S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H2,1,2,3,4).
What are the key properties of hydron;triethylazanium;sulfate?
hydron;triethylazanium;sulfate has a molecular weight of 199.27 g/mol, XLogP of -1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;triethylazanium;sulfate is sourced from PubChem (CID 18786689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).