C16H13N3O4 — CID 18786708
benzene-1,4-dicarboxamide;isoindole-1,3-dione (PubChem CID 18786708) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;isoindole-1,3-dione.
| Compound Name | benzene-1,4-dicarboxamide;isoindole-1,3-dione |
|---|---|
| PubChem CID | 18786708 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | benzene-1,4-dicarboxamide;isoindole-1,3-dione |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H8N2O2.C8H5NO2/c9-7(11)5-1-2-6(4-3-5)8(10)12;10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H2,9,11)(H2,10,12);1-4H,(H,9,10,11) |
| InChIKey | BTKPIDYMOVEOGD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|