About (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol
(3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol (PubChem CID 18786824) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol.
Molecular Properties
| Compound Name | (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol |
| PubChem CID | 18786824 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/C(O)CS |
| InChI | InChI=1S/C11H20OS/c1-9(2)5-4-6-10(3)7-11(12)8-13/h5,7,11-13H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | BDVOQIZDJRJZDW-JXMROGBWSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol?
The IUPAC name of (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol (CID 18786824) is (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol.
What is the SMILES notation for (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol?
The canonical SMILES for (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol is CC(C)=CCC/C(C)=C/C(O)CS.
What is the InChIKey of (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol?
The InChIKey is BDVOQIZDJRJZDW-JXMROGBWSA-N. The full InChI is InChI=1S/C11H20OS/c1-9(2)5-4-6-10(3)7-11(12)8-13/h5,7,11-13H,4,6,8H2,1-3H3/b10-7+.
What are the key properties of (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol?
(3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol has a molecular weight of 200.35 g/mol, XLogP of 2.97, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4,8-dimethyl-1-sulfanylnona-3,7-dien-2-ol is sourced from PubChem (CID 18786824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).