About 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide
2-amino-N-cyclohexa-1,4-dien-1-ylacetamide (PubChem CID 18786860) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide.
Molecular Properties
| Compound Name | 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide |
| PubChem CID | 18786860 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide |
| SMILES | NCC(=O)NC1=CCC=CC1 |
| InChI | InChI=1S/C8H12N2O/c9-6-8(11)10-7-4-2-1-3-5-7/h1-2,5H,3-4,6,9H2,(H,10,11) |
| InChIKey | ZEWMKRQHUCTMHA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide?
The IUPAC name of 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide (CID 18786860) is 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide.
What is the SMILES notation for 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide?
The canonical SMILES for 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide is NCC(=O)NC1=CCC=CC1.
What is the InChIKey of 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide?
The InChIKey is ZEWMKRQHUCTMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-6-8(11)10-7-4-2-1-3-5-7/h1-2,5H,3-4,6,9H2,(H,10,11).
What are the key properties of 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide?
2-amino-N-cyclohexa-1,4-dien-1-ylacetamide has a molecular weight of 152.20 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-cyclohexa-1,4-dien-1-ylacetamide is sourced from PubChem (CID 18786860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).