C14H14Cl2FN3O5S — CID 18786884
1-chloro-N-[2-chloro-4-fluoro-5-(7-hydroxy-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)phenyl]methanesulfonamide (PubChem CID 18786884) has the molecular formula C14H14Cl2FN3O5S and a molecular weight of 426.25 g/mol. Its IUPAC name is 1-chloro-N-[2-chloro-4-fluoro-5-(7-hydroxy-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)phenyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[2-chloro-4-fluoro-5-(7-hydroxy-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18786884 |
| Molecular Formula | C14H14Cl2FN3O5S |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 1-chloro-N-[2-chloro-4-fluoro-5-(7-hydroxy-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)phenyl]methanesulfonamide |
| SMILES | O=C1C2CC(O)CCN2C(=O)N1c1cc(NS(=O)(=O)CCl)c(Cl)cc1F |
| InChI | InChI=1S/C14H14Cl2FN3O5S/c15-6-26(24,25)18-10-5-11(9(17)4-8(10)16)20-13(22)12-3-7(21)1-2-19(12)14(20)23/h4-5,7,12,18,21H,1-3,6H2 |
| InChIKey | XWOGGMWBXSFJHV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|