C13H11Cl3FN3O4S — CID 18786886
1-chloro-N-[2-chloro-5-(6-chloro-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4-fluorophenyl]methanesulfonamide (PubChem CID 18786886) has the molecular formula C13H11Cl3FN3O4S and a molecular weight of 430.67 g/mol. Its IUPAC name is 1-chloro-N-[2-chloro-5-(6-chloro-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4-fluorophenyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[2-chloro-5-(6-chloro-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18786886 |
| Molecular Formula | C13H11Cl3FN3O4S |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | 1-chloro-N-[2-chloro-5-(6-chloro-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-4-fluorophenyl]methanesulfonamide |
| SMILES | O=C1C2CC(Cl)CN2C(=O)N1c1cc(NS(=O)(=O)CCl)c(Cl)cc1F |
| InChI | InChI=1S/C13H11Cl3FN3O4S/c14-5-25(23,24)18-9-3-10(8(17)2-7(9)16)20-12(21)11-1-6(15)4-19(11)13(20)22/h2-3,6,11,18H,1,4-5H2 |
| InChIKey | HXZGOBFLJKSYCQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|