About CID 18787773
CID 18787773 (PubChem CID 18787773) has the molecular formula C6H12F3O3Si2
and a molecular weight of 245.32 g/mol.
Molecular Properties
| Compound Name | CID 18787773 |
| PubChem CID | 18787773 |
| Molecular Formula | C6H12F3O3Si2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | — |
| SMILES | C[Si](OC(=O)C(F)(F)F)O[Si](C)(C)C |
| InChI | InChI=1S/C6H12F3O3Si2/c1-13(12-14(2,3)4)11-5(10)6(7,8)9/h1-4H3 |
| InChIKey | YBJLSGMFXBUCNF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18787773 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18787773?
The IUPAC name of CID 18787773 (CID 18787773) is not available.
What is the SMILES notation for CID 18787773?
The canonical SMILES for CID 18787773 is C[Si](OC(=O)C(F)(F)F)O[Si](C)(C)C.
What is the InChIKey of CID 18787773?
The InChIKey is YBJLSGMFXBUCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F3O3Si2/c1-13(12-14(2,3)4)11-5(10)6(7,8)9/h1-4H3.
What are the key properties of CID 18787773?
CID 18787773 has a molecular weight of 245.32 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18787773 is sourced from PubChem (CID 18787773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).