C16H21F13O — CID 18787823
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-octoxyoctane (PubChem CID 18787823) has the molecular formula C16H21F13O and a molecular weight of 476.32 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-octoxyoctane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-octoxyoctane |
|---|---|
| PubChem CID | 18787823 |
| Molecular Formula | C16H21F13O |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-octoxyoctane |
| SMILES | CCCCCCCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H21F13O/c1-2-3-4-5-6-7-9-30-10-8-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h2-10H2,1H3 |
| InChIKey | QSFVKSSVKFVLCH-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|