C15H15ClF3N3O3 — CID 18788060
3-[4-chloro-3-[(methoxyamino)methyl]phenyl]-1-methyl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 18788060) has the molecular formula C15H15ClF3N3O3 and a molecular weight of 377.75 g/mol. Its IUPAC name is 3-[4-chloro-3-[(methoxyamino)methyl]phenyl]-1-methyl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 3-[4-chloro-3-[(methoxyamino)methyl]phenyl]-1-methyl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18788060 |
| Molecular Formula | C15H15ClF3N3O3 |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[4-chloro-3-[(methoxyamino)methyl]phenyl]-1-methyl-6-(1,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | CONCc1cc(-n2c(=O)cc(C(F)C(F)F)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C15H15ClF3N3O3/c1-21-11(13(17)14(18)19)6-12(23)22(15(21)24)9-3-4-10(16)8(5-9)7-20-25-2/h3-6,13-14,20H,7H2,1-2H3 |
| InChIKey | SATAZMAWMHVTKE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|