C26H25N3O — CID 18788163
9-benzyl-N-(3-methylphenyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide (PubChem CID 18788163) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is 9-benzyl-N-(3-methylphenyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 9-benzyl-N-(3-methylphenyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 18788163 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 9-benzyl-N-(3-methylphenyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCc3c(n(Cc4ccccc4)c4ccccc34)C2)c1 |
| InChI | InChI=1S/C26H25N3O/c1-19-8-7-11-21(16-19)27-26(30)28-15-14-23-22-12-5-6-13-24(22)29(25(23)18-28)17-20-9-3-2-4-10-20/h2-13,16H,14-15,17-18H2,1H3,(H,27,30) |
| InChIKey | GINQAFWRNUMSHY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|