About 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide
2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide (PubChem CID 18788247) has the molecular formula C10H15N3O2S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 18788247 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCCCCC(=O)c1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C10H15N3O2S/c11-5-3-1-2-4-8(14)10-13-7(6-16-10)9(12)15/h6H,1-5,11H2,(H2,12,15) |
| InChIKey | YGSJQOSVFXQYIV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide (CID 18788247) is 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide is NCCCCCC(=O)c1nc(C(N)=O)cs1.
What is the InChIKey of 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide?
The InChIKey is YGSJQOSVFXQYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c11-5-3-1-2-4-8(14)10-13-7(6-16-10)9(12)15/h6H,1-5,11H2,(H2,12,15).
What are the key properties of 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide?
2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide has a molecular weight of 241.32 g/mol, XLogP of 0.94, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-aminohexanoyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 18788247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).