About 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol
3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol (PubChem CID 18788479) has the molecular formula C19H18F2O4S
and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol |
| PubChem CID | 18788479 |
| Molecular Formula | C19H18F2O4S |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol |
| SMILES | CC1(C)OC(O)C(c2cc(F)cc(F)c2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H18F2O4S/c1-19(2)17(11-4-6-15(7-5-11)26(3,23)24)16(18(22)25-19)12-8-13(20)10-14(21)9-12/h4-10,18,22H,1-3H3 |
| InChIKey | TYCIQSPLNIGWBZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol?
The IUPAC name of 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol (CID 18788479) is 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol.
What is the SMILES notation for 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol?
The canonical SMILES for 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol is CC1(C)OC(O)C(c2cc(F)cc(F)c2)=C1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol?
The InChIKey is TYCIQSPLNIGWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F2O4S/c1-19(2)17(11-4-6-15(7-5-11)26(3,23)24)16(18(22)25-19)12-8-13(20)10-14(21)9-12/h4-10,18,22H,1-3H3.
What are the key properties of 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol?
3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol has a molecular weight of 380.41 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-ol is sourced from PubChem (CID 18788479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).