About 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan
3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan (PubChem CID 18788483) has the molecular formula C22H25FO4S
and a molecular weight of 404.50 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan.
Molecular Properties
| Compound Name | 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan |
| PubChem CID | 18788483 |
| Molecular Formula | C22H25FO4S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan |
| SMILES | CC(C)OC1OC(C)(C)C(c2ccc(S(C)(=O)=O)cc2)=C1c1cccc(F)c1 |
| InChI | InChI=1S/C22H25FO4S/c1-14(2)26-21-19(16-7-6-8-17(23)13-16)20(22(3,4)27-21)15-9-11-18(12-10-15)28(5,24)25/h6-14,21H,1-5H3 |
| InChIKey | IUIXRXUTLABYPM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan?
The IUPAC name of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan (CID 18788483) is 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan.
What is the SMILES notation for 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan?
The canonical SMILES for 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan is CC(C)OC1OC(C)(C)C(c2ccc(S(C)(=O)=O)cc2)=C1c1cccc(F)c1.
What is the InChIKey of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan?
The InChIKey is IUIXRXUTLABYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FO4S/c1-14(2)26-21-19(16-7-6-8-17(23)13-16)20(22(3,4)27-21)15-9-11-18(12-10-15)28(5,24)25/h6-14,21H,1-5H3.
What are the key properties of 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan?
3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan has a molecular weight of 404.50 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2-propan-2-yloxy-2H-furan is sourced from PubChem (CID 18788483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).