About [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate
[3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate (PubChem CID 18788490) has the molecular formula C21H21FO5S
and a molecular weight of 404.46 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate.
Molecular Properties
| Compound Name | [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate |
| PubChem CID | 18788490 |
| Molecular Formula | C21H21FO5S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate |
| SMILES | CC(=O)OC1OC(C)(C)C(c2ccc(S(C)(=O)=O)cc2)=C1c1cccc(F)c1 |
| InChI | InChI=1S/C21H21FO5S/c1-13(23)26-20-18(15-6-5-7-16(22)12-15)19(21(2,3)27-20)14-8-10-17(11-9-14)28(4,24)25/h5-12,20H,1-4H3 |
| InChIKey | MKHOKOSEPTVVLW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate?
The IUPAC name of [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate (CID 18788490) is [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate.
What is the SMILES notation for [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate?
The canonical SMILES for [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate is CC(=O)OC1OC(C)(C)C(c2ccc(S(C)(=O)=O)cc2)=C1c1cccc(F)c1.
What is the InChIKey of [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate?
The InChIKey is MKHOKOSEPTVVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FO5S/c1-13(23)26-20-18(15-6-5-7-16(22)12-15)19(21(2,3)27-20)14-8-10-17(11-9-14)28(4,24)25/h5-12,20H,1-4H3.
What are the key properties of [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate?
[3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate has a molecular weight of 404.46 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-fluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)-2H-furan-2-yl] acetate is sourced from PubChem (CID 18788490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).