About 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol
3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol (PubChem CID 18788497) has the molecular formula C17H14F2O4S
and a molecular weight of 352.36 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol |
| PubChem CID | 18788497 |
| Molecular Formula | C17H14F2O4S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(F)c(F)c3)C(O)OC2)cc1 |
| InChI | InChI=1S/C17H14F2O4S/c1-24(21,22)12-5-2-10(3-6-12)13-9-23-17(20)16(13)11-4-7-14(18)15(19)8-11/h2-8,17,20H,9H2,1H3 |
| InChIKey | LJDPSQRQUXNPPC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol?
The IUPAC name of 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol (CID 18788497) is 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol.
What is the SMILES notation for 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol?
The canonical SMILES for 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol is CS(=O)(=O)c1ccc(C2=C(c3ccc(F)c(F)c3)C(O)OC2)cc1.
What is the InChIKey of 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol?
The InChIKey is LJDPSQRQUXNPPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2O4S/c1-24(21,22)12-5-2-10(3-6-12)13-9-23-17(20)16(13)11-4-7-14(18)15(19)8-11/h2-8,17,20H,9H2,1H3.
What are the key properties of 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol?
3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol has a molecular weight of 352.36 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)-4-(4-methylsulfonylphenyl)-2,5-dihydrofuran-2-ol is sourced from PubChem (CID 18788497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).