About 6-bromopyridine-3,4-diamine
6-bromopyridine-3,4-diamine (PubChem CID 18788657) has the molecular formula C5H6BrN3
and a molecular weight of 188.03 g/mol. Its IUPAC name is 6-bromopyridine-3,4-diamine.
Molecular Properties
| Compound Name | 6-bromopyridine-3,4-diamine |
| PubChem CID | 18788657 |
| Molecular Formula | C5H6BrN3 |
| Molecular Weight | 188.03 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 6-bromopyridine-3,4-diamine |
| SMILES | Nc1cnc(Br)cc1N |
| InChI | InChI=1S/C5H6BrN3/c6-5-1-3(7)4(8)2-9-5/h1-2H,8H2,(H2,7,9) |
| InChIKey | XCVAQMLOGLDTNX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.03 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromopyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromopyridine-3,4-diamine?
The IUPAC name of 6-bromopyridine-3,4-diamine (CID 18788657) is 6-bromopyridine-3,4-diamine.
What is the SMILES notation for 6-bromopyridine-3,4-diamine?
The canonical SMILES for 6-bromopyridine-3,4-diamine is Nc1cnc(Br)cc1N.
What is the InChIKey of 6-bromopyridine-3,4-diamine?
The InChIKey is XCVAQMLOGLDTNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrN3/c6-5-1-3(7)4(8)2-9-5/h1-2H,8H2,(H2,7,9).
What are the key properties of 6-bromopyridine-3,4-diamine?
6-bromopyridine-3,4-diamine has a molecular weight of 188.03 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromopyridine-3,4-diamine is sourced from PubChem (CID 18788657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).