C19H22N2 — CID 18788976
5-(2-phenylethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 18788976) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 5-(2-phenylethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | 5-(2-phenylethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 18788976 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 5-(2-phenylethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | c1ccc(CCN2c3ccccc3C3CNCCC32)cc1 |
| InChI | InChI=1S/C19H22N2/c1-2-6-15(7-3-1)11-13-21-18-9-5-4-8-16(18)17-14-20-12-10-19(17)21/h1-9,17,19-20H,10-14H2 |
| InChIKey | BQXJDRZCEBPLSB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |