C17H19N5O — CID 18788993
2-(7H-purin-6-ylamino)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)ethanol (PubChem CID 18788993) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(7H-purin-6-ylamino)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)ethanol.
| Compound Name | 2-(7H-purin-6-ylamino)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 18788993 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(7H-purin-6-ylamino)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)ethanol |
| SMILES | OCC(Nc1ncnc2nc[nH]c12)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H19N5O/c23-8-14(13-6-5-11-3-1-2-4-12(11)7-13)22-17-15-16(19-9-18-15)20-10-21-17/h1-4,9-10,13-14,23H,5-8H2,(H2,18,19,20,21,22) |
| InChIKey | DKPDPVDMHMUFGU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |