C24H27Cl2N3O3S — CID 18789281
3-phenylpropyl 6-(2-aminoethoxymethyl)-4-(3,4-dichlorophenyl)-2-methylsulfanyl-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 18789281) has the molecular formula C24H27Cl2N3O3S and a molecular weight of 508.47 g/mol. Its IUPAC name is 3-phenylpropyl 6-(2-aminoethoxymethyl)-4-(3,4-dichlorophenyl)-2-methylsulfanyl-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | 3-phenylpropyl 6-(2-aminoethoxymethyl)-4-(3,4-dichlorophenyl)-2-methylsulfanyl-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 18789281 |
| Molecular Formula | C24H27Cl2N3O3S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 3-phenylpropyl 6-(2-aminoethoxymethyl)-4-(3,4-dichlorophenyl)-2-methylsulfanyl-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CSC1=NC(c2ccc(Cl)c(Cl)c2)C(C(=O)OCCCc2ccccc2)=C(COCCN)N1 |
| InChI | InChI=1S/C24H27Cl2N3O3S/c1-33-24-28-20(15-31-13-11-27)21(22(29-24)17-9-10-18(25)19(26)14-17)23(30)32-12-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-10,14,22H,5,8,11-13,15,27H2,1H3,(H,28,29) |
| InChIKey | WCZPWDWIBMEQLA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|