About N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide
N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide (PubChem CID 18789628) has the molecular formula C11H15N3O4S
and a molecular weight of 285.32 g/mol. Its IUPAC name is N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide |
| PubChem CID | 18789628 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(OCC2=NCCN2)ccc1O |
| InChI | InChI=1S/C11H15N3O4S/c1-19(16,17)14-9-6-8(2-3-10(9)15)18-7-11-12-4-5-13-11/h2-3,6,14-15H,4-5,7H2,1H3,(H,12,13) |
| InChIKey | KLOYNZJZQMXEQF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide?
The IUPAC name of N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide (CID 18789628) is N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide.
What is the SMILES notation for N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide?
The canonical SMILES for N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide is CS(=O)(=O)Nc1cc(OCC2=NCCN2)ccc1O.
What is the InChIKey of N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide?
The InChIKey is KLOYNZJZQMXEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O4S/c1-19(16,17)14-9-6-8(2-3-10(9)15)18-7-11-12-4-5-13-11/h2-3,6,14-15H,4-5,7H2,1H3,(H,12,13).
What are the key properties of N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide?
N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide has a molecular weight of 285.32 g/mol, XLogP of 0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-hydroxyphenyl]methanesulfonamide is sourced from PubChem (CID 18789628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).